About 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine
6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine (PubChem CID 168867616) has the molecular formula C15H16N3OP
and a molecular weight of 285.29 g/mol. Its IUPAC name is 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine.
Molecular Properties
| Compound Name | 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine |
| PubChem CID | 168867616 |
| Molecular Formula | C15H16N3OP |
| Molecular Weight | 285.29 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine |
| SMILES | Cn1c(P(C)(C)=O)cc2c(-c3ccccc3)ncnc21 |
| InChI | InChI=1S/C15H16N3OP/c1-18-13(20(2,3)19)9-12-14(16-10-17-15(12)18)11-7-5-4-6-8-11/h4-10H,1-3H3 |
| InChIKey | JLLAPMMDUIOGPU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.29 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine?
The IUPAC name of 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine (CID 168867616) is 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine.
What is the SMILES notation for 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine?
The canonical SMILES for 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine is Cn1c(P(C)(C)=O)cc2c(-c3ccccc3)ncnc21.
What is the InChIKey of 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine?
The InChIKey is JLLAPMMDUIOGPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16N3OP/c1-18-13(20(2,3)19)9-12-14(16-10-17-15(12)18)11-7-5-4-6-8-11/h4-10H,1-3H3.
What are the key properties of 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine?
6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine has a molecular weight of 285.29 g/mol, XLogP of 2.88, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-dimethylphosphoryl-7-methyl-4-phenylpyrrolo[2,3-d]pyrimidine is sourced from PubChem (CID 168867616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).