C30H34FN7O2S2 — CID 168867739
4-[2-(1-ethylsulfonylpiperidin-4-yl)-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine (PubChem CID 168867739) has the molecular formula C30H34FN7O2S2 and a molecular weight of 607.78 g/mol. Its IUPAC name is 4-[2-(1-ethylsulfonylpiperidin-4-yl)-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine.
| Compound Name | 4-[2-(1-ethylsulfonylpiperidin-4-yl)-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 168867739 |
| Molecular Formula | C30H34FN7O2S2 |
| Molecular Weight | 607.78 g/mol |
| Exact Mass | 607.22 |
| IUPAC Name | 4-[2-(1-ethylsulfonylpiperidin-4-yl)-4-(4-fluorophenyl)-1,3-thiazol-5-yl]-N-(4-piperazin-1-ylphenyl)pyrimidin-2-amine |
| SMILES | CCS(=O)(=O)N1CCC(c2nc(-c3ccc(F)cc3)c(-c3ccnc(Nc4ccc(N5CCNCC5)cc4)n3)s2)CC1 |
| InChI | InChI=1S/C30H34FN7O2S2/c1-2-42(39,40)38-17-12-22(13-18-38)29-36-27(21-3-5-23(31)6-4-21)28(41-29)26-11-14-33-30(35-26)34-24-7-9-25(10-8-24)37-19-15-32-16-20-37/h3-11,14,22,32H,2,12-13,15-20H2,1H3,(H,33,34,35) |
| InChIKey | FWJPUININROYBN-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 103.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 607.78 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|