C15H16F3N7O4S — CID 168867808
N-hydroxy-4-[(1-sulfamoyl-2,3-dihydropyrrol-5-yl)methylamino]-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 168867808) has the molecular formula C15H16F3N7O4S and a molecular weight of 447.40 g/mol. Its IUPAC name is N-hydroxy-4-[(1-sulfamoyl-2,3-dihydropyrrol-5-yl)methylamino]-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | N-hydroxy-4-[(1-sulfamoyl-2,3-dihydropyrrol-5-yl)methylamino]-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 168867808 |
| Molecular Formula | C15H16F3N7O4S |
| Molecular Weight | 447.40 g/mol |
| Exact Mass | 447.09 |
| IUPAC Name | N-hydroxy-4-[(1-sulfamoyl-2,3-dihydropyrrol-5-yl)methylamino]-N'-[4-(trifluoromethyl)phenyl]-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | NS(=O)(=O)N1CCC=C1CNc1nonc1/C(=N/c1ccc(C(F)(F)F)cc1)NO |
| InChI | InChI=1S/C15H16F3N7O4S/c16-15(17,18)9-3-5-10(6-4-9)21-14(22-26)12-13(24-29-23-12)20-8-11-2-1-7-25(11)30(19,27)28/h2-6,26H,1,7-8H2,(H,20,24)(H,21,22)(H2,19,27,28) |
| InChIKey | QWWUGCFPUYWHDT-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 158.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.40 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|