About N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine
N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 168868692) has the molecular formula C17H21N5S
and a molecular weight of 327.46 g/mol. Its IUPAC name is N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 168868692 |
| Molecular Formula | C17H21N5S |
| Molecular Weight | 327.46 g/mol |
| Exact Mass | 327.15 |
| IUPAC Name | N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Cc1cc(C)n(-c2nc(NC3CCCCC3)c3ccsc3n2)n1 |
| InChI | InChI=1S/C17H21N5S/c1-11-10-12(2)22(21-11)17-19-15(14-8-9-23-16(14)20-17)18-13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3,(H,18,19,20) |
| InChIKey | QFASUEXHBKAOQS-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.46 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine (CID 168868692) is N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine is Cc1cc(C)n(-c2nc(NC3CCCCC3)c3ccsc3n2)n1.
What is the InChIKey of N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine?
The InChIKey is QFASUEXHBKAOQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N5S/c1-11-10-12(2)22(21-11)17-19-15(14-8-9-23-16(14)20-17)18-13-6-4-3-5-7-13/h8-10,13H,3-7H2,1-2H3,(H,18,19,20).
What are the key properties of N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine?
N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine has a molecular weight of 327.46 g/mol, XLogP of 4.24, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-cyclohexyl-2-(3,5-dimethylpyrazol-1-yl)thieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 168868692), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).