About 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine
2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine (PubChem CID 168868709) has the molecular formula C16H21N5S
and a molecular weight of 315.45 g/mol. Its IUPAC name is 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine.
Molecular Properties
| Compound Name | 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine |
| PubChem CID | 168868709 |
| Molecular Formula | C16H21N5S |
| Molecular Weight | 315.45 g/mol |
| Exact Mass | 315.15 |
| IUPAC Name | 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine |
| SMILES | CCC(CC)Nc1nc(-n2nc(C)cc2C)nc2sccc12 |
| InChI | InChI=1S/C16H21N5S/c1-5-12(6-2)17-14-13-7-8-22-15(13)19-16(18-14)21-11(4)9-10(3)20-21/h7-9,12H,5-6H2,1-4H3,(H,17,18,19) |
| InChIKey | UJAUPKDIGHMDAE-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 55.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.45 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine?
The IUPAC name of 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine (CID 168868709) is 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine.
What is the SMILES notation for 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine?
The canonical SMILES for 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine is CCC(CC)Nc1nc(-n2nc(C)cc2C)nc2sccc12.
What is the InChIKey of 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine?
The InChIKey is UJAUPKDIGHMDAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21N5S/c1-5-12(6-2)17-14-13-7-8-22-15(13)19-16(18-14)21-11(4)9-10(3)20-21/h7-9,12H,5-6H2,1-4H3,(H,17,18,19).
What are the key properties of 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine?
2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine has a molecular weight of 315.45 g/mol, XLogP of 4.09, 5 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(3,5-dimethylpyrazol-1-yl)-N-pentan-3-ylthieno[2,3-d]pyrimidin-4-amine is sourced from PubChem (CID 168868709), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).