About 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride
1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride (PubChem CID 168868763) has the molecular formula C8H9FO2S
and a molecular weight of 188.22 g/mol. Its IUPAC name is 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride.
Molecular Properties
| Compound Name | 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride |
| PubChem CID | 168868763 |
| Molecular Formula | C8H9FO2S |
| Molecular Weight | 188.22 g/mol |
| Exact Mass | 188.03 |
| IUPAC Name | 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride |
| SMILES | C=CC1(S(=O)(=O)F)C=CC=CC1 |
| InChI | InChI=1S/C8H9FO2S/c1-2-8(12(9,10)11)6-4-3-5-7-8/h2-6H,1,7H2 |
| InChIKey | NVMZINWAMVCHPQ-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.22 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The IUPAC name of 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride (CID 168868763) is 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride.
What is the SMILES notation for 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The canonical SMILES for 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride is C=CC1(S(=O)(=O)F)C=CC=CC1.
What is the InChIKey of 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride?
The InChIKey is NVMZINWAMVCHPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9FO2S/c1-2-8(12(9,10)11)6-4-3-5-7-8/h2-6H,1,7H2.
What are the key properties of 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride?
1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride has a molecular weight of 188.22 g/mol, XLogP of 1.73, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethenylcyclohexa-2,4-diene-1-sulfonyl fluoride is sourced from PubChem (CID 168868763), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).