C17H29BN2O3 — CID 168868978
3-methyl-1-(oxan-2-yl)-5-(1,1,2,2,2-pentadeuterioethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole (PubChem CID 168868978) has the molecular formula C17H29BN2O3 and a molecular weight of 325.27 g/mol. Its IUPAC name is 3-methyl-1-(oxan-2-yl)-5-(1,1,2,2,2-pentadeuterioethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole.
| Compound Name | 3-methyl-1-(oxan-2-yl)-5-(1,1,2,2,2-pentadeuterioethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
|---|---|
| PubChem CID | 168868978 |
| Molecular Formula | C17H29BN2O3 |
| Molecular Weight | 325.27 g/mol |
| Exact Mass | 325.26 |
| IUPAC Name | 3-methyl-1-(oxan-2-yl)-5-(1,1,2,2,2-pentadeuterioethyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyrazole |
| SMILES | [2H]C([2H])([2H])C([2H])([2H])c1c(B2OC(C)(C)C(C)(C)O2)c(C)nn1C1CCCCO1 |
| InChI | InChI=1S/C17H29BN2O3/c1-7-13-15(18-22-16(3,4)17(5,6)23-18)12(2)19-20(13)14-10-8-9-11-21-14/h14H,7-11H2,1-6H3/i1D3,7D2 |
| InChIKey | IFDPMHZQYFHYBV-WRMAMSRYSA-N |
| XLogP | 2.75 |
| TPSA | 45.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.27 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|