C25H16F15NO — CID 168869295
1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrol-2-ol (PubChem CID 168869295) has the molecular formula C25H16F15NO and a molecular weight of 631.38 g/mol. Its IUPAC name is 1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrol-2-ol.
| Compound Name | 1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrol-2-ol |
|---|---|
| PubChem CID | 168869295 |
| Molecular Formula | C25H16F15NO |
| Molecular Weight | 631.38 g/mol |
| Exact Mass | 631.10 |
| IUPAC Name | 1-benzyl-5-[3,5-bis(trifluoromethyl)phenyl]-4-methyl-3-(2,2,3,3,4,4,5,5,5-nonafluoropentyl)pyrrol-2-ol |
| SMILES | Cc1c(CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c(O)n(Cc2ccccc2)c1-c1cc(C(F)(F)F)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C25H16F15NO/c1-12-17(10-20(26,27)23(34,35)24(36,37)25(38,39)40)19(42)41(11-13-5-3-2-4-6-13)18(12)14-7-15(21(28,29)30)9-16(8-14)22(31,32)33/h2-9,42H,10-11H2,1H3 |
| InChIKey | GBBRQMVYWHOLGO-UHFFFAOYSA-N |
| XLogP | 9.27 |
| TPSA | 25.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.38 |
| LogP ≤ 5 | 9.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|