C16H13F3N2S — CID 168869312
7-methyl-7-(2,2,2-trifluoroethyl)-3-thia-9,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),4,10,12,14-hexaene (PubChem CID 168869312) has the molecular formula C16H13F3N2S and a molecular weight of 322.36 g/mol. Its IUPAC name is 7-methyl-7-(2,2,2-trifluoroethyl)-3-thia-9,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),4,10,12,14-hexaene.
| Compound Name | 7-methyl-7-(2,2,2-trifluoroethyl)-3-thia-9,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),4,10,12,14-hexaene |
|---|---|
| PubChem CID | 168869312 |
| Molecular Formula | C16H13F3N2S |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.08 |
| IUPAC Name | 7-methyl-7-(2,2,2-trifluoroethyl)-3-thia-9,16-diazatetracyclo[7.7.0.02,6.010,15]hexadeca-1(16),2(6),4,10,12,14-hexaene |
| SMILES | CC1(CC(F)(F)F)Cn2c(nc3ccccc32)-c2sccc21 |
| InChI | InChI=1S/C16H13F3N2S/c1-15(8-16(17,18)19)9-21-12-5-3-2-4-11(12)20-14(21)13-10(15)6-7-22-13/h2-7H,8-9H2,1H3 |
| InChIKey | WVEBWJWJLQGICR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |