C13H16N2O5 — CID 168869716
5-nitro-N-(oxan-4-ylmethyl)-1,3-benzodioxol-4-amine (PubChem CID 168869716) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is 5-nitro-N-(oxan-4-ylmethyl)-1,3-benzodioxol-4-amine.
| Compound Name | 5-nitro-N-(oxan-4-ylmethyl)-1,3-benzodioxol-4-amine |
|---|---|
| PubChem CID | 168869716 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | 5-nitro-N-(oxan-4-ylmethyl)-1,3-benzodioxol-4-amine |
| SMILES | O=[N+]([O-])c1ccc2c(c1NCC1CCOCC1)OCO2 |
| InChI | InChI=1S/C13H16N2O5/c16-15(17)10-1-2-11-13(20-8-19-11)12(10)14-7-9-3-5-18-6-4-9/h1-2,9,14H,3-8H2 |
| InChIKey | PSFDDIUABUOLFA-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 82.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|