C25H33N3O2 — CID 16886993
N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide (PubChem CID 16886993) has the molecular formula C25H33N3O2 and a molecular weight of 407.56 g/mol. Its IUPAC name is N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide.
| Compound Name | N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide |
|---|---|
| PubChem CID | 16886993 |
| Molecular Formula | C25H33N3O2 |
| Molecular Weight | 407.56 g/mol |
| Exact Mass | 407.26 |
| IUPAC Name | N-[[1-(2-phenylethyl)piperidin-4-yl]methyl]-N'-(4-propan-2-ylphenyl)oxamide |
| SMILES | CC(C)c1ccc(NC(=O)C(=O)NCC2CCN(CCc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C25H33N3O2/c1-19(2)22-8-10-23(11-9-22)27-25(30)24(29)26-18-21-13-16-28(17-14-21)15-12-20-6-4-3-5-7-20/h3-11,19,21H,12-18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | XYNNFBWPNYMVIJ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.56 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|