C20H27N5O2 — CID 168870495
1-[2-(1-tert-butylpiperidin-4-yl)indazol-5-yl]-1,3-diazinane-2,4-dione (PubChem CID 168870495) has the molecular formula C20H27N5O2 and a molecular weight of 369.47 g/mol. Its IUPAC name is 1-[2-(1-tert-butylpiperidin-4-yl)indazol-5-yl]-1,3-diazinane-2,4-dione.
| Compound Name | 1-[2-(1-tert-butylpiperidin-4-yl)indazol-5-yl]-1,3-diazinane-2,4-dione |
|---|---|
| PubChem CID | 168870495 |
| Molecular Formula | C20H27N5O2 |
| Molecular Weight | 369.47 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | 1-[2-(1-tert-butylpiperidin-4-yl)indazol-5-yl]-1,3-diazinane-2,4-dione |
| SMILES | CC(C)(C)N1CCC(n2cc3cc(N4CCC(=O)NC4=O)ccc3n2)CC1 |
| InChI | InChI=1S/C20H27N5O2/c1-20(2,3)23-9-6-15(7-10-23)25-13-14-12-16(4-5-17(14)22-25)24-11-8-18(26)21-19(24)27/h4-5,12-13,15H,6-11H2,1-3H3,(H,21,26,27) |
| InChIKey | CNGCBJQSIDGQOK-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.47 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |