C42H43BrN10O4 — CID 168870725
6-[[[1-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperidin-4-yl]-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168870725) has the molecular formula C42H43BrN10O4 and a molecular weight of 831.78 g/mol. Its IUPAC name is 6-[[[1-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperidin-4-yl]-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 6-[[[1-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperidin-4-yl]-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168870725 |
| Molecular Formula | C42H43BrN10O4 |
| Molecular Weight | 831.78 g/mol |
| Exact Mass | 830.27 |
| IUPAC Name | 6-[[[1-[4-[(8-anilino-9-cyclopentylpurin-2-yl)amino]phenyl]piperidin-4-yl]-methylamino]methyl]-4-bromo-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | CN(Cc1cc(Br)c2c(c1)C(=O)N(C1CCC(=O)NC1=O)C2=O)C1CCN(c2ccc(Nc3ncc4nc(Nc5ccccc5)n(C5CCCC5)c4n3)cc2)CC1 |
| InChI | InChI=1S/C42H43BrN10O4/c1-50(24-25-21-31-36(32(43)22-25)40(57)53(39(31)56)34-15-16-35(54)48-38(34)55)28-17-19-51(20-18-28)29-13-11-27(12-14-29)45-41-44-23-33-37(49-41)52(30-9-5-6-10-30)42(47-33)46-26-7-3-2-4-8-26/h2-4,7-8,11-14,21-23,28,30,34H,5-6,9-10,15-20,24H2,1H3,(H,46,47)(H,44,45,49)(H,48,54,55) |
| InChIKey | XZPOUFAAYSELHN-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 157.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.78 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|