C21H25BrN4O4 — CID 168870834
4-[[4-(3-bromopropyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione (PubChem CID 168870834) has the molecular formula C21H25BrN4O4 and a molecular weight of 477.36 g/mol. Its IUPAC name is 4-[[4-(3-bromopropyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione.
| Compound Name | 4-[[4-(3-bromopropyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
|---|---|
| PubChem CID | 168870834 |
| Molecular Formula | C21H25BrN4O4 |
| Molecular Weight | 477.36 g/mol |
| Exact Mass | 476.11 |
| IUPAC Name | 4-[[4-(3-bromopropyl)piperazin-1-yl]methyl]-2-(2,6-dioxopiperidin-3-yl)isoindole-1,3-dione |
| SMILES | O=C1CCC(N2C(=O)c3cccc(CN4CCN(CCCBr)CC4)c3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H25BrN4O4/c22-7-2-8-24-9-11-25(12-10-24)13-14-3-1-4-15-18(14)21(30)26(20(15)29)16-5-6-17(27)23-19(16)28/h1,3-4,16H,2,5-13H2,(H,23,27,28) |
| InChIKey | KXEWMCJEMOUBAQ-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.36 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|