About 2-aminotriazole-4,5-dicarbonitrile
2-aminotriazole-4,5-dicarbonitrile (PubChem CID 168872851) has the molecular formula C4H2N6
and a molecular weight of 134.10 g/mol. Its IUPAC name is 2-aminotriazole-4,5-dicarbonitrile.
Molecular Properties
| Compound Name | 2-aminotriazole-4,5-dicarbonitrile |
| PubChem CID | 168872851 |
| Molecular Formula | C4H2N6 |
| Molecular Weight | 134.10 g/mol |
| Exact Mass | 134.03 |
| IUPAC Name | 2-aminotriazole-4,5-dicarbonitrile |
| SMILES | N#Cc1nn(N)nc1C#N |
| InChI | InChI=1S/C4H2N6/c5-1-3-4(2-6)9-10(7)8-3/h7H2 |
| InChIKey | MEOFGRXZJFZZBS-UHFFFAOYSA-N |
| XLogP | -1.26 |
| TPSA | 104.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.10 |
| LogP ≤ 5 | -1.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 2-aminotriazole-4,5-dicarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminotriazole-4,5-dicarbonitrile?
The IUPAC name of 2-aminotriazole-4,5-dicarbonitrile (CID 168872851) is 2-aminotriazole-4,5-dicarbonitrile.
What is the SMILES notation for 2-aminotriazole-4,5-dicarbonitrile?
The canonical SMILES for 2-aminotriazole-4,5-dicarbonitrile is N#Cc1nn(N)nc1C#N.
What is the InChIKey of 2-aminotriazole-4,5-dicarbonitrile?
The InChIKey is MEOFGRXZJFZZBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H2N6/c5-1-3-4(2-6)9-10(7)8-3/h7H2.
What are the key properties of 2-aminotriazole-4,5-dicarbonitrile?
2-aminotriazole-4,5-dicarbonitrile has a molecular weight of 134.10 g/mol, XLogP of -1.26, 0 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminotriazole-4,5-dicarbonitrile is sourced from PubChem (CID 168872851), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).