About 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone
1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone (PubChem CID 168873068) has the molecular formula C14H9Br2NO3S
and a molecular weight of 431.11 g/mol. Its IUPAC name is 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone.
Molecular Properties
| Compound Name | 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone |
| PubChem CID | 168873068 |
| Molecular Formula | C14H9Br2NO3S |
| Molecular Weight | 431.11 g/mol |
| Exact Mass | 428.87 |
| IUPAC Name | 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone |
| SMILES | CC(=O)N1c2ccc(Br)cc2S(=O)(=O)c2cc(Br)ccc21 |
| InChI | InChI=1S/C14H9Br2NO3S/c1-8(18)17-11-4-2-9(15)6-13(11)21(19,20)14-7-10(16)3-5-12(14)17/h2-7H,1H3 |
| InChIKey | ZOSYGFOHFNOXRO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.11 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone?
The IUPAC name of 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone (CID 168873068) is 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone.
What is the SMILES notation for 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone?
The canonical SMILES for 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone is CC(=O)N1c2ccc(Br)cc2S(=O)(=O)c2cc(Br)ccc21.
What is the InChIKey of 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone?
The InChIKey is ZOSYGFOHFNOXRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9Br2NO3S/c1-8(18)17-11-4-2-9(15)6-13(11)21(19,20)14-7-10(16)3-5-12(14)17/h2-7H,1H3.
What are the key properties of 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone?
1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone has a molecular weight of 431.11 g/mol, XLogP of 4.04, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3,7-dibromo-5,5-dioxophenothiazin-10-yl)ethanone is sourced from PubChem (CID 168873068), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).