About 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile
2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile (PubChem CID 168873350) has the molecular formula C24H14Br2N2O3
and a molecular weight of 538.20 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile.
Molecular Properties
| Compound Name | 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile |
| PubChem CID | 168873350 |
| Molecular Formula | C24H14Br2N2O3 |
| Molecular Weight | 538.20 g/mol |
| Exact Mass | 535.94 |
| IUPAC Name | 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile |
| SMILES | N#CC(C#N)=C1C=C(/C=C/c2cc(Br)ccc2O)OC(/C=C/c2cc(Br)ccc2O)=C1 |
| InChI | InChI=1S/C24H14Br2N2O3/c25-19-3-7-23(29)15(9-19)1-5-21-11-17(18(13-27)14-28)12-22(31-21)6-2-16-10-20(26)4-8-24(16)30/h1-12,29-30H/b5-1+,6-2+ |
| InChIKey | IITJJOCANDLRIB-IJIVKGSJSA-N |
| XLogP | 6.49 |
| TPSA | 97.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 538.20 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile?
The IUPAC name of 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile (CID 168873350) is 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile.
What is the SMILES notation for 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile?
The canonical SMILES for 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile is N#CC(C#N)=C1C=C(/C=C/c2cc(Br)ccc2O)OC(/C=C/c2cc(Br)ccc2O)=C1.
What is the InChIKey of 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile?
The InChIKey is IITJJOCANDLRIB-IJIVKGSJSA-N. The full InChI is InChI=1S/C24H14Br2N2O3/c25-19-3-7-23(29)15(9-19)1-5-21-11-17(18(13-27)14-28)12-22(31-21)6-2-16-10-20(26)4-8-24(16)30/h1-12,29-30H/b5-1+,6-2+.
What are the key properties of 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile?
2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile has a molecular weight of 538.20 g/mol, XLogP of 6.49, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-bis[(E)-2-(5-bromo-2-hydroxyphenyl)ethenyl]pyran-4-ylidene]propanedinitrile is sourced from PubChem (CID 168873350), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).