C20H14BrF2N3O2 — CID 168873950
1-[(4-bromo-2,6-difluorophenyl)methyl]-8-ethoxypyrido[3,2-c][1,8]naphthyridin-2-one (PubChem CID 168873950) has the molecular formula C20H14BrF2N3O2 and a molecular weight of 446.25 g/mol. Its IUPAC name is 1-[(4-bromo-2,6-difluorophenyl)methyl]-8-ethoxypyrido[3,2-c][1,8]naphthyridin-2-one.
| Compound Name | 1-[(4-bromo-2,6-difluorophenyl)methyl]-8-ethoxypyrido[3,2-c][1,8]naphthyridin-2-one |
|---|---|
| PubChem CID | 168873950 |
| Molecular Formula | C20H14BrF2N3O2 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.02 |
| IUPAC Name | 1-[(4-bromo-2,6-difluorophenyl)methyl]-8-ethoxypyrido[3,2-c][1,8]naphthyridin-2-one |
| SMILES | CCOc1ccc2c(ncc3ccc(=O)n(Cc4c(F)cc(Br)cc4F)c32)n1 |
| InChI | InChI=1S/C20H14BrF2N3O2/c1-2-28-17-5-4-13-19-11(9-24-20(13)25-17)3-6-18(27)26(19)10-14-15(22)7-12(21)8-16(14)23/h3-9H,2,10H2,1H3 |
| InChIKey | BSKITLSZXOKBMF-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|