About 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one (PubChem CID 168874444) has the molecular formula C27H21BrN2O4
and a molecular weight of 517.38 g/mol. Its IUPAC name is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one.
Molecular Properties
| Compound Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one |
| PubChem CID | 168874444 |
| Molecular Formula | C27H21BrN2O4 |
| Molecular Weight | 517.38 g/mol |
| Exact Mass | 516.07 |
| IUPAC Name | 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one |
| SMILES | Cc1cc(Br)c2oc(=O)n(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)c2c1 |
| InChI | InChI=1S/C27H21BrN2O4/c1-18-14-21(28)25-23(15-18)30(27(31)34-25)22-12-13-24(32-16-19-8-4-2-5-9-19)29-26(22)33-17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3 |
| InChIKey | YMCJRTQZRFSWQX-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 66.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 517.38 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one?
The IUPAC name of 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one (CID 168874444) is 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one.
What is the SMILES notation for 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one?
The canonical SMILES for 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one is Cc1cc(Br)c2oc(=O)n(-c3ccc(OCc4ccccc4)nc3OCc3ccccc3)c2c1.
What is the InChIKey of 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one?
The InChIKey is YMCJRTQZRFSWQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H21BrN2O4/c1-18-14-21(28)25-23(15-18)30(27(31)34-25)22-12-13-24(32-16-19-8-4-2-5-9-19)29-26(22)33-17-20-10-6-3-7-11-20/h2-15H,16-17H2,1H3.
What are the key properties of 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one?
3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one has a molecular weight of 517.38 g/mol, XLogP of 6.21, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2,6-bis(phenylmethoxy)-3-pyridinyl]-7-bromo-5-methyl-1,3-benzoxazol-2-one is sourced from PubChem (CID 168874444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).