C17H27N3O3S — CID 16887477
2-methyl-N-[4-[(1-methylpiperidin-4-yl)methylsulfamoyl]phenyl]propanamide (PubChem CID 16887477) has the molecular formula C17H27N3O3S and a molecular weight of 353.49 g/mol. Its IUPAC name is 2-methyl-N-[4-[(1-methylpiperidin-4-yl)methylsulfamoyl]phenyl]propanamide.
| Compound Name | 2-methyl-N-[4-[(1-methylpiperidin-4-yl)methylsulfamoyl]phenyl]propanamide |
|---|---|
| PubChem CID | 16887477 |
| Molecular Formula | C17H27N3O3S |
| Molecular Weight | 353.49 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-methyl-N-[4-[(1-methylpiperidin-4-yl)methylsulfamoyl]phenyl]propanamide |
| SMILES | CC(C)C(=O)Nc1ccc(S(=O)(=O)NCC2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C17H27N3O3S/c1-13(2)17(21)19-15-4-6-16(7-5-15)24(22,23)18-12-14-8-10-20(3)11-9-14/h4-7,13-14,18H,8-12H2,1-3H3,(H,19,21) |
| InChIKey | MMSNAQMBIFEESO-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.49 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |