About 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one
3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one (PubChem CID 168875457) has the molecular formula C20H22F3NO2
and a molecular weight of 365.40 g/mol. Its IUPAC name is 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one.
Molecular Properties
| Compound Name | 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one |
| PubChem CID | 168875457 |
| Molecular Formula | C20H22F3NO2 |
| Molecular Weight | 365.40 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one |
| SMILES | CCCCC1(O)C2=C(C=CCC2)C(=O)N1Cc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H22F3NO2/c1-2-3-12-19(26)17-7-5-4-6-16(17)18(25)24(19)13-14-8-10-15(11-9-14)20(21,22)23/h4,6,8-11,26H,2-3,5,7,12-13H2,1H3 |
| InChIKey | RAFTZFMYJHYPEZ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.40 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one?
The IUPAC name of 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one (CID 168875457) is 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one.
What is the SMILES notation for 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one?
The canonical SMILES for 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one is CCCCC1(O)C2=C(C=CCC2)C(=O)N1Cc1ccc(C(F)(F)F)cc1.
What is the InChIKey of 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one?
The InChIKey is RAFTZFMYJHYPEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H22F3NO2/c1-2-3-12-19(26)17-7-5-4-6-16(17)18(25)24(19)13-14-8-10-15(11-9-14)20(21,22)23/h4,6,8-11,26H,2-3,5,7,12-13H2,1H3.
What are the key properties of 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one?
3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one has a molecular weight of 365.40 g/mol, XLogP of 4.57, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-butyl-3-hydroxy-2-[[4-(trifluoromethyl)phenyl]methyl]-4,5-dihydroisoindol-1-one is sourced from PubChem (CID 168875457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).