C22H15F5N2O4S — CID 168876101
N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-2-[(5Z)-2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide (PubChem CID 168876101) has the molecular formula C22H15F5N2O4S and a molecular weight of 498.43 g/mol. Its IUPAC name is N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-2-[(5Z)-2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide.
| Compound Name | N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-2-[(5Z)-2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
|---|---|
| PubChem CID | 168876101 |
| Molecular Formula | C22H15F5N2O4S |
| Molecular Weight | 498.43 g/mol |
| Exact Mass | 498.07 |
| IUPAC Name | N-[(1R,2S)-2-(3,4-difluorophenyl)cyclopropyl]-2-[(5Z)-2,4-dioxo-5-[[4-(trifluoromethoxy)phenyl]methylidene]-1,3-thiazolidin-3-yl]acetamide |
| SMILES | O=C(CN1C(=O)S/C(=C\c2ccc(OC(F)(F)F)cc2)C1=O)N[C@@H]1C[C@H]1c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C22H15F5N2O4S/c23-15-6-3-12(8-16(15)24)14-9-17(14)28-19(30)10-29-20(31)18(34-21(29)32)7-11-1-4-13(5-2-11)33-22(25,26)27/h1-8,14,17H,9-10H2,(H,28,30)/b18-7-/t14-,17+/m0/s1 |
| InChIKey | ARMWIRANXITVBY-DUWDARIISA-N |
| XLogP | 4.57 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.43 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|