C43H38F2N5O6Si — CID 168876123
CID 168876123 (PubChem CID 168876123) has the molecular formula C43H38F2N5O6Si and a molecular weight of 786.89 g/mol.
| Compound Name | CID 168876123 |
|---|---|
| PubChem CID | 168876123 |
| Molecular Formula | C43H38F2N5O6Si |
| Molecular Weight | 786.89 g/mol |
| Exact Mass | 786.26 |
| IUPAC Name | — |
| SMILES | Cc1cc(=O)n(-c2ccc(F)cc2)nc1C(=O)Nc1ccc(Oc2ccnc(C(=O)ON3CC(O[Si](c4ccccc4)c4ccc(C(C)(C)C)cc4)C3)c2)c(F)c1 |
| InChI | InChI=1S/C43H38F2N5O6Si/c1-27-22-39(51)50(31-15-12-29(44)13-16-31)48-40(27)41(52)47-30-14-19-38(36(45)23-30)54-32-20-21-46-37(24-32)42(53)55-49-25-33(26-49)56-57(34-8-6-5-7-9-34)35-17-10-28(11-18-35)43(2,3)4/h5-24,33H,25-26H2,1-4H3,(H,47,52) |
| InChIKey | PXLIEJSECXSQJY-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 124.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 786.89 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|