About 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine
2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine (PubChem CID 168876188) has the molecular formula C18H21NO2
and a molecular weight of 283.37 g/mol. Its IUPAC name is 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine.
Molecular Properties
| Compound Name | 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine |
| PubChem CID | 168876188 |
| Molecular Formula | C18H21NO2 |
| Molecular Weight | 283.37 g/mol |
| Exact Mass | 283.16 |
| IUPAC Name | 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine |
| SMILES | CCC1(CC)Oc2ccccc2C(c2ccccc2)N1O |
| InChI | InChI=1S/C18H21NO2/c1-3-18(4-2)19(20)17(14-10-6-5-7-11-14)15-12-8-9-13-16(15)21-18/h5-13,17,20H,3-4H2,1-2H3 |
| InChIKey | LWWGWDMDQNFXKS-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine?
The IUPAC name of 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine (CID 168876188) is 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine.
What is the SMILES notation for 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine?
The canonical SMILES for 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine is CCC1(CC)Oc2ccccc2C(c2ccccc2)N1O.
What is the InChIKey of 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine?
The InChIKey is LWWGWDMDQNFXKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H21NO2/c1-3-18(4-2)19(20)17(14-10-6-5-7-11-14)15-12-8-9-13-16(15)21-18/h5-13,17,20H,3-4H2,1-2H3.
What are the key properties of 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine?
2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine has a molecular weight of 283.37 g/mol, XLogP of 4.38, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,2-diethyl-3-hydroxy-4-phenyl-4H-1,3-benzoxazine is sourced from PubChem (CID 168876188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).