C14H17ClN2O3 — CID 168876998
4-(azetidin-3-yloxy)-2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] (PubChem CID 168876998) has the molecular formula C14H17ClN2O3 and a molecular weight of 296.75 g/mol. Its IUPAC name is 4-(azetidin-3-yloxy)-2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane].
| Compound Name | 4-(azetidin-3-yloxy)-2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
|---|---|
| PubChem CID | 168876998 |
| Molecular Formula | C14H17ClN2O3 |
| Molecular Weight | 296.75 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | 4-(azetidin-3-yloxy)-2-chlorospiro[5,6-dihydropyrano[3,4-b]pyridine-8,3'-oxolane] |
| SMILES | Clc1cc(OC2CNC2)c2c(n1)C1(CCOC1)OCC2 |
| InChI | InChI=1S/C14H17ClN2O3/c15-12-5-11(20-9-6-16-7-9)10-1-3-19-14(13(10)17-12)2-4-18-8-14/h5,9,16H,1-4,6-8H2 |
| InChIKey | FFBFDAALXDYLRG-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 52.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.75 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|