C16H14ClF2N5O2 — CID 168877171
N-[4-[chloro(difluoro)methoxy]phenyl]-3-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine (PubChem CID 168877171) has the molecular formula C16H14ClF2N5O2 and a molecular weight of 381.77 g/mol. Its IUPAC name is N-[4-[chloro(difluoro)methoxy]phenyl]-3-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine.
| Compound Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
|---|---|
| PubChem CID | 168877171 |
| Molecular Formula | C16H14ClF2N5O2 |
| Molecular Weight | 381.77 g/mol |
| Exact Mass | 381.08 |
| IUPAC Name | N-[4-[chloro(difluoro)methoxy]phenyl]-3-[5-(methylaminomethyl)-1,3,4-oxadiazol-2-yl]pyridin-2-amine |
| SMILES | CNCc1nnc(-c2cccnc2Nc2ccc(OC(F)(F)Cl)cc2)o1 |
| InChI | InChI=1S/C16H14ClF2N5O2/c1-20-9-13-23-24-15(25-13)12-3-2-8-21-14(12)22-10-4-6-11(7-5-10)26-16(17,18)19/h2-8,20H,9H2,1H3,(H,21,22) |
| InChIKey | GCUCMXZRIKDBKJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 85.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.77 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|