C7H9NO3 — CID 168877175
4-methyl-3-oxo-2-azabicyclo[3.1.0]hexane-4-carboxylic acid (PubChem CID 168877175) has the molecular formula C7H9NO3 and a molecular weight of 155.15 g/mol. Its IUPAC name is 4-methyl-3-oxo-2-azabicyclo[3.1.0]hexane-4-carboxylic acid.
| Compound Name | 4-methyl-3-oxo-2-azabicyclo[3.1.0]hexane-4-carboxylic acid |
|---|---|
| PubChem CID | 168877175 |
| Molecular Formula | C7H9NO3 |
| Molecular Weight | 155.15 g/mol |
| Exact Mass | 155.06 |
| IUPAC Name | 4-methyl-3-oxo-2-azabicyclo[3.1.0]hexane-4-carboxylic acid |
| SMILES | CC1(C(=O)O)C(=O)NC2CC21 |
| InChI | InChI=1S/C7H9NO3/c1-7(6(10)11)3-2-4(3)8-5(7)9/h3-4H,2H2,1H3,(H,8,9)(H,10,11) |
| InChIKey | ANGCJEXEVRDGPL-UHFFFAOYSA-N |
| XLogP | -0.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 155.15 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|