C22H20F2N2O2S2 — CID 168877472
4-[[[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]methyldisulfanyl]methyl]-3,5-dimethyl-1,2-oxazole (PubChem CID 168877472) has the molecular formula C22H20F2N2O2S2 and a molecular weight of 446.54 g/mol. Its IUPAC name is 4-[[[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]methyldisulfanyl]methyl]-3,5-dimethyl-1,2-oxazole.
| Compound Name | 4-[[[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]methyldisulfanyl]methyl]-3,5-dimethyl-1,2-oxazole |
|---|---|
| PubChem CID | 168877472 |
| Molecular Formula | C22H20F2N2O2S2 |
| Molecular Weight | 446.54 g/mol |
| Exact Mass | 446.09 |
| IUPAC Name | 4-[[[4-[2-(2,6-difluorophenyl)-4,5-dihydro-1,3-oxazol-4-yl]phenyl]methyldisulfanyl]methyl]-3,5-dimethyl-1,2-oxazole |
| SMILES | Cc1noc(C)c1CSSCc1ccc(C2COC(c3c(F)cccc3F)=N2)cc1 |
| InChI | InChI=1S/C22H20F2N2O2S2/c1-13-17(14(2)28-26-13)12-30-29-11-15-6-8-16(9-7-15)20-10-27-22(25-20)21-18(23)4-3-5-19(21)24/h3-9,20H,10-12H2,1-2H3 |
| InChIKey | OEQULAUVERBIJK-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 47.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.54 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|