About 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide
2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide (PubChem CID 168877669) has the molecular formula C13H18FN3O2
and a molecular weight of 267.30 g/mol. Its IUPAC name is 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide.
Molecular Properties
| Compound Name | 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide |
| PubChem CID | 168877669 |
| Molecular Formula | C13H18FN3O2 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.14 |
| IUPAC Name | 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide |
| SMILES | CC(C(N)=O)N1CC[C@H](F)[C@@H](c2ccc(=O)[nH]c2)C1 |
| InChI | InChI=1S/C13H18FN3O2/c1-8(13(15)19)17-5-4-11(14)10(7-17)9-2-3-12(18)16-6-9/h2-3,6,8,10-11H,4-5,7H2,1H3,(H2,15,19)(H,16,18)/t8?,10-,11+/m1/s1 |
| InChIKey | RYSQBJIHDMIFRG-JROPRLTOSA-N |
| XLogP | 0.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide?
The IUPAC name of 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide (CID 168877669) is 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide.
What is the SMILES notation for 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide?
The canonical SMILES for 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide is CC(C(N)=O)N1CC[C@H](F)[C@@H](c2ccc(=O)[nH]c2)C1.
What is the InChIKey of 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide?
The InChIKey is RYSQBJIHDMIFRG-JROPRLTOSA-N. The full InChI is InChI=1S/C13H18FN3O2/c1-8(13(15)19)17-5-4-11(14)10(7-17)9-2-3-12(18)16-6-9/h2-3,6,8,10-11H,4-5,7H2,1H3,(H2,15,19)(H,16,18)/t8?,10-,11+/m1/s1.
What are the key properties of 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide?
2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide has a molecular weight of 267.30 g/mol, XLogP of 0.38, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(3S,4S)-4-fluoro-3-(6-oxo-1H-pyridin-3-yl)piperidin-1-yl]propanamide is sourced from PubChem (CID 168877669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).