C21H28N2O2S — CID 16887788
N-[(1-benzylpiperidin-4-yl)methyl]-3,4-dimethylbenzenesulfonamide (PubChem CID 16887788) has the molecular formula C21H28N2O2S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 16887788 |
| Molecular Formula | C21H28N2O2S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.19 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCC2CCN(Cc3ccccc3)CC2)cc1C |
| InChI | InChI=1S/C21H28N2O2S/c1-17-8-9-21(14-18(17)2)26(24,25)22-15-19-10-12-23(13-11-19)16-20-6-4-3-5-7-20/h3-9,14,19,22H,10-13,15-16H2,1-2H3 |
| InChIKey | ZFQUEXYZBSKMTB-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |