2-[(2,3-dimethylcyclopropyl)amino]acetic acid

C7H13NO2 — CID 168878066

IUPAC2-[(2,3-dimethylcyclopropyl)amino]acetic acid
SMILESCC1C(C)C1NCC(=O)O
InChIInChI=1S/C7H13NO2/c1-4-5(2)7(4)8-3-6(9)10/h4-5,7-8H,3H2,1-2H3,(H,9,10)
InChIKeyIKHVBACDFRFDQS-UHFFFAOYSA-N
MW143.19 g/mol
LogP0.31
Rot. Bonds3

About 2-[(2,3-dimethylcyclopropyl)amino]acetic acid

2-[(2,3-dimethylcyclopropyl)amino]acetic acid (PubChem CID 168878066) has the molecular formula C7H13NO2 and a molecular weight of 143.19 g/mol. Its IUPAC name is 2-[(2,3-dimethylcyclopropyl)amino]acetic acid.

Molecular Properties

Compound Name2-[(2,3-dimethylcyclopropyl)amino]acetic acid
PubChem CID168878066
Molecular FormulaC7H13NO2
Molecular Weight143.19 g/mol
Exact Mass143.09
IUPAC Name2-[(2,3-dimethylcyclopropyl)amino]acetic acid
SMILESCC1C(C)C1NCC(=O)O
InChIInChI=1S/C7H13NO2/c1-4-5(2)7(4)8-3-6(9)10/h4-5,7-8H,3H2,1-2H3,(H,9,10)
InChIKeyIKHVBACDFRFDQS-UHFFFAOYSA-N
XLogP0.31
TPSA49.33 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds3
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500143.19
LogP ≤ 50.31
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-[(2,3-dimethylcyclopropyl)amino]acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(2,3-dimethylcyclopropyl)amino]acetic acid?
The IUPAC name of 2-[(2,3-dimethylcyclopropyl)amino]acetic acid (CID 168878066) is 2-[(2,3-dimethylcyclopropyl)amino]acetic acid.
What is the SMILES notation for 2-[(2,3-dimethylcyclopropyl)amino]acetic acid?
The canonical SMILES for 2-[(2,3-dimethylcyclopropyl)amino]acetic acid is CC1C(C)C1NCC(=O)O.
What is the InChIKey of 2-[(2,3-dimethylcyclopropyl)amino]acetic acid?
The InChIKey is IKHVBACDFRFDQS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2/c1-4-5(2)7(4)8-3-6(9)10/h4-5,7-8H,3H2,1-2H3,(H,9,10).
What are the key properties of 2-[(2,3-dimethylcyclopropyl)amino]acetic acid?
2-[(2,3-dimethylcyclopropyl)amino]acetic acid has a molecular weight of 143.19 g/mol, XLogP of 0.31, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(2,3-dimethylcyclopropyl)amino]acetic acid is sourced from PubChem (CID 168878066), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).