About methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate
methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate (PubChem CID 168878610) has the molecular formula C17H22O4
and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate.
Molecular Properties
| Compound Name | methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate |
| PubChem CID | 168878610 |
| Molecular Formula | C17H22O4 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.15 |
| IUPAC Name | methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate |
| SMILES | C=CCC(CC=C)Oc1cc(C)c(C(=O)OC)c(O)c1C |
| InChI | InChI=1S/C17H22O4/c1-6-8-13(9-7-2)21-14-10-11(3)15(17(19)20-5)16(18)12(14)4/h6-7,10,13,18H,1-2,8-9H2,3-5H3 |
| InChIKey | HZENNVTWJWABKI-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate?
The IUPAC name of methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate (CID 168878610) is methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate.
What is the SMILES notation for methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate?
The canonical SMILES for methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate is C=CCC(CC=C)Oc1cc(C)c(C(=O)OC)c(O)c1C.
What is the InChIKey of methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate?
The InChIKey is HZENNVTWJWABKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H22O4/c1-6-8-13(9-7-2)21-14-10-11(3)15(17(19)20-5)16(18)12(14)4/h6-7,10,13,18H,1-2,8-9H2,3-5H3.
What are the key properties of methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate?
methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate has a molecular weight of 290.36 g/mol, XLogP of 3.70, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 4-hepta-1,6-dien-4-yloxy-2-hydroxy-3,6-dimethylbenzoate is sourced from PubChem (CID 168878610), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).