About 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane
5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane (PubChem CID 168880201) has the molecular formula C13H24F2N2
and a molecular weight of 246.34 g/mol. Its IUPAC name is 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane.
Molecular Properties
| Compound Name | 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane |
| PubChem CID | 168880201 |
| Molecular Formula | C13H24F2N2 |
| Molecular Weight | 246.34 g/mol |
| Exact Mass | 246.19 |
| IUPAC Name | 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane |
| SMILES | CC.CCn1nc(C(C)C)cc1C(F)(F)CC |
| InChI | InChI=1S/C11H18F2N2.C2H6/c1-5-11(12,13)10-7-9(8(3)4)14-15(10)6-2;1-2/h7-8H,5-6H2,1-4H3;1-2H3 |
| InChIKey | OTGJAZUAPGEGOV-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.34 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane?
The IUPAC name of 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane (CID 168880201) is 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane.
What is the SMILES notation for 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane?
The canonical SMILES for 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane is CC.CCn1nc(C(C)C)cc1C(F)(F)CC.
What is the InChIKey of 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane?
The InChIKey is OTGJAZUAPGEGOV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18F2N2.C2H6/c1-5-11(12,13)10-7-9(8(3)4)14-15(10)6-2;1-2/h7-8H,5-6H2,1-4H3;1-2H3.
What are the key properties of 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane?
5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane has a molecular weight of 246.34 g/mol, XLogP of 4.55, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1,1-difluoropropyl)-1-ethyl-3-propan-2-ylpyrazole;ethane is sourced from PubChem (CID 168880201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).