About ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen
ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen (PubChem CID 168880628) has the molecular formula C13H26N2O2
and a molecular weight of 242.36 g/mol. Its IUPAC name is ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen.
Molecular Properties
| Compound Name | ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen |
| PubChem CID | 168880628 |
| Molecular Formula | C13H26N2O2 |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.20 |
| IUPAC Name | ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen |
| SMILES | C/C=C(CNC(=O)C(=O)C(C)C)\N=C\C.CC.[H][H] |
| InChI | InChI=1S/C11H18N2O2.C2H6.H2/c1-5-9(12-6-2)7-13-11(15)10(14)8(3)4;1-2;/h5-6,8H,7H2,1-4H3,(H,13,15);1-2H3;1H/b9-5-,12-6+;; |
| InChIKey | DERXXKXDQFJJMR-RLQPUMDASA-N |
| XLogP | 2.59 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen?
The IUPAC name of ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen (CID 168880628) is ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen.
What is the SMILES notation for ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen?
The canonical SMILES for ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen is C/C=C(CNC(=O)C(=O)C(C)C)\N=C\C.CC.[H][H].
What is the InChIKey of ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen?
The InChIKey is DERXXKXDQFJJMR-RLQPUMDASA-N. The full InChI is InChI=1S/C11H18N2O2.C2H6.H2/c1-5-9(12-6-2)7-13-11(15)10(14)8(3)4;1-2;/h5-6,8H,7H2,1-4H3,(H,13,15);1-2H3;1H/b9-5-,12-6+;;.
What are the key properties of ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen?
ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen has a molecular weight of 242.36 g/mol, XLogP of 2.59, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;N-[(Z)-2-(ethylideneamino)but-2-enyl]-3-methyl-2-oxobutanamide;molecular hydrogen is sourced from PubChem (CID 168880628), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).