C33H43ClF2N6O2 — CID 168880757
2-[4-[6-[3-(2-chlorophenyl)propyl]-2-methoxy-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine (PubChem CID 168880757) has the molecular formula C33H43ClF2N6O2 and a molecular weight of 629.20 g/mol. Its IUPAC name is 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-methoxy-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine.
| Compound Name | 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-methoxy-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
|---|---|
| PubChem CID | 168880757 |
| Molecular Formula | C33H43ClF2N6O2 |
| Molecular Weight | 629.20 g/mol |
| Exact Mass | 628.31 |
| IUPAC Name | 2-[4-[6-[3-(2-chlorophenyl)propyl]-2-methoxy-5-propylpyrimidin-4-yl]-1-(2-fluoroprop-2-enoyl)piperazin-2-yl]acetonitrile;2-fluoro-2,3,5,6,7,8-hexahydro-1H-pyrrolizine |
| SMILES | C=C(F)C(=O)N1CCN(c2nc(OC)nc(CCCc3ccccc3Cl)c2CCC)CC1CC#N.FC1CC2CCCN2C1 |
| InChI | InChI=1S/C26H31ClFN5O2.C7H12FN/c1-4-8-21-23(12-7-10-19-9-5-6-11-22(19)27)30-26(35-3)31-24(21)32-15-16-33(25(34)18(2)28)20(17-32)13-14-29;8-6-4-7-2-1-3-9(7)5-6/h5-6,9,11,20H,2,4,7-8,10,12-13,15-17H2,1,3H3;6-7H,1-5H2 |
| InChIKey | MJEZCTQUQQRBKM-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 85.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 629.20 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|