C19H24ClN3O2S — CID 16888080
1-(3-chlorophenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]methanesulfonamide (PubChem CID 16888080) has the molecular formula C19H24ClN3O2S and a molecular weight of 393.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]methanesulfonamide.
| Compound Name | 1-(3-chlorophenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]methanesulfonamide |
|---|---|
| PubChem CID | 16888080 |
| Molecular Formula | C19H24ClN3O2S |
| Molecular Weight | 393.94 g/mol |
| Exact Mass | 393.13 |
| IUPAC Name | 1-(3-chlorophenyl)-N-[[1-(pyridin-4-ylmethyl)piperidin-4-yl]methyl]methanesulfonamide |
| SMILES | O=S(=O)(Cc1cccc(Cl)c1)NCC1CCN(Cc2ccncc2)CC1 |
| InChI | InChI=1S/C19H24ClN3O2S/c20-19-3-1-2-18(12-19)15-26(24,25)22-13-16-6-10-23(11-7-16)14-17-4-8-21-9-5-17/h1-5,8-9,12,16,22H,6-7,10-11,13-15H2 |
| InChIKey | GRBCBEOGXYFIGX-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.94 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |