C9H16FNO — CID 168880850
[(2R,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol (PubChem CID 168880850) has the molecular formula C9H16FNO and a molecular weight of 173.23 g/mol. Its IUPAC name is [(2R,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol.
| Compound Name | [(2R,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
|---|---|
| PubChem CID | 168880850 |
| Molecular Formula | C9H16FNO |
| Molecular Weight | 173.23 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | [(2R,8R)-2-fluoro-5-methyl-1,2,3,5,6,7-hexahydropyrrolizin-8-yl]methanol |
| SMILES | CC1CC[C@]2(CO)C[C@@H](F)CN12 |
| InChI | InChI=1S/C9H16FNO/c1-7-2-3-9(6-12)4-8(10)5-11(7)9/h7-8,12H,2-6H2,1H3/t7?,8-,9-/m1/s1 |
| InChIKey | JNALTWHBNAXBIO-CFCGPWAMSA-N |
| XLogP | 0.94 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.23 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |