C10H17F2NO — CID 168880905
(3R,8R)-3-(difluoromethyl)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 168880905) has the molecular formula C10H17F2NO and a molecular weight of 205.25 g/mol. Its IUPAC name is (3R,8R)-3-(difluoromethyl)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (3R,8R)-3-(difluoromethyl)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 168880905 |
| Molecular Formula | C10H17F2NO |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | (3R,8R)-3-(difluoromethyl)-8-(methoxymethyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | COC[C@]12CCCN1[C@@H](C(F)F)CC2 |
| InChI | InChI=1S/C10H17F2NO/c1-14-7-10-4-2-6-13(10)8(3-5-10)9(11)12/h8-9H,2-7H2,1H3/t8-,10-/m1/s1 |
| InChIKey | IPDWEVPVJKMLJD-PSASIEDQSA-N |
| XLogP | 1.89 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |