About CID 168880910
CID 168880910 (PubChem CID 168880910) has the molecular formula C14H24NO
and a molecular weight of 222.35 g/mol.
Molecular Properties
| Compound Name | CID 168880910 |
| PubChem CID | 168880910 |
| Molecular Formula | C14H24NO |
| Molecular Weight | 222.35 g/mol |
| Exact Mass | 222.19 |
| IUPAC Name | — |
| SMILES | CCCC(CC1=C[CH]1)N1CCC[C@@H]1COC |
| InChI | InChI=1S/C14H24NO/c1-3-5-13(10-12-7-8-12)15-9-4-6-14(15)11-16-2/h7-8,13-14H,3-6,9-11H2,1-2H3/t13?,14-/m1/s1 |
| InChIKey | QZOIFDGQPGOSOS-ARLHGKGLSA-N |
| XLogP | 2.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 222.35 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze CID 168880910 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 168880910?
The IUPAC name of CID 168880910 (CID 168880910) is not available.
What is the SMILES notation for CID 168880910?
The canonical SMILES for CID 168880910 is CCCC(CC1=C[CH]1)N1CCC[C@@H]1COC.
What is the InChIKey of CID 168880910?
The InChIKey is QZOIFDGQPGOSOS-ARLHGKGLSA-N. The full InChI is InChI=1S/C14H24NO/c1-3-5-13(10-12-7-8-12)15-9-4-6-14(15)11-16-2/h7-8,13-14H,3-6,9-11H2,1-2H3/t13?,14-/m1/s1.
What are the key properties of CID 168880910?
CID 168880910 has a molecular weight of 222.35 g/mol, XLogP of 2.80, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 168880910 is sourced from PubChem (CID 168880910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).