C13H27F2NO — CID 168880948
4-(difluoromethoxy)-2,2-dipropylhexan-1-amine (PubChem CID 168880948) has the molecular formula C13H27F2NO and a molecular weight of 251.36 g/mol. Its IUPAC name is 4-(difluoromethoxy)-2,2-dipropylhexan-1-amine.
| Compound Name | 4-(difluoromethoxy)-2,2-dipropylhexan-1-amine |
|---|---|
| PubChem CID | 168880948 |
| Molecular Formula | C13H27F2NO |
| Molecular Weight | 251.36 g/mol |
| Exact Mass | 251.21 |
| IUPAC Name | 4-(difluoromethoxy)-2,2-dipropylhexan-1-amine |
| SMILES | CCCC(CN)(CCC)CC(CC)OC(F)F |
| InChI | InChI=1S/C13H27F2NO/c1-4-7-13(10-16,8-5-2)9-11(6-3)17-12(14)15/h11-12H,4-10,16H2,1-3H3 |
| InChIKey | QYVFCJZUQACPJF-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.36 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |