About (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene
(3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene (PubChem CID 168880987) has the molecular formula C13H23FO
and a molecular weight of 214.32 g/mol. Its IUPAC name is (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene.
Molecular Properties
| Compound Name | (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene |
| PubChem CID | 168880987 |
| Molecular Formula | C13H23FO |
| Molecular Weight | 214.32 g/mol |
| Exact Mass | 214.17 |
| IUPAC Name | (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene |
| SMILES | CC[C@H](F)C[C@]1(COC)C=C(C)[C@@H](C)C1 |
| InChI | InChI=1S/C13H23FO/c1-5-12(14)8-13(9-15-4)6-10(2)11(3)7-13/h6,11-12H,5,7-9H2,1-4H3/t11-,12-,13-/m0/s1 |
| InChIKey | YZQCZYMDWOLKQA-AVGNSLFASA-N |
| XLogP | 3.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.32 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene?
The IUPAC name of (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene (CID 168880987) is (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene.
What is the SMILES notation for (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene?
The canonical SMILES for (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene is CC[C@H](F)C[C@]1(COC)C=C(C)[C@@H](C)C1.
What is the InChIKey of (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene?
The InChIKey is YZQCZYMDWOLKQA-AVGNSLFASA-N. The full InChI is InChI=1S/C13H23FO/c1-5-12(14)8-13(9-15-4)6-10(2)11(3)7-13/h6,11-12H,5,7-9H2,1-4H3/t11-,12-,13-/m0/s1.
What are the key properties of (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene?
(3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene has a molecular weight of 214.32 g/mol, XLogP of 3.74, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,5S)-3-[(2S)-2-fluorobutyl]-3-(methoxymethyl)-1,5-dimethylcyclopentene is sourced from PubChem (CID 168880987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).