C14H27FO — CID 168881135
(6S,7S,8R)-8-fluoro-6-(methoxymethyl)-6,7-dimethyldec-1-ene (PubChem CID 168881135) has the molecular formula C14H27FO and a molecular weight of 230.37 g/mol. Its IUPAC name is (6S,7S,8R)-8-fluoro-6-(methoxymethyl)-6,7-dimethyldec-1-ene.
| Compound Name | (6S,7S,8R)-8-fluoro-6-(methoxymethyl)-6,7-dimethyldec-1-ene |
|---|---|
| PubChem CID | 168881135 |
| Molecular Formula | C14H27FO |
| Molecular Weight | 230.37 g/mol |
| Exact Mass | 230.20 |
| IUPAC Name | (6S,7S,8R)-8-fluoro-6-(methoxymethyl)-6,7-dimethyldec-1-ene |
| SMILES | C=CCCC[C@](C)(COC)[C@H](C)[C@H](F)CC |
| InChI | InChI=1S/C14H27FO/c1-6-8-9-10-14(4,11-16-5)12(3)13(15)7-2/h6,12-13H,1,7-11H2,2-5H3/t12-,13-,14-/m1/s1 |
| InChIKey | GVUARLPWHADUTM-MGPQQGTHSA-N |
| XLogP | 4.38 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.37 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|