C12H22FNO — CID 168881165
(2S,8R)-8-(butoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 168881165) has the molecular formula C12H22FNO and a molecular weight of 215.31 g/mol. Its IUPAC name is (2S,8R)-8-(butoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (2S,8R)-8-(butoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 168881165 |
| Molecular Formula | C12H22FNO |
| Molecular Weight | 215.31 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (2S,8R)-8-(butoxymethyl)-2-fluoro-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | CCCCOC[C@]12CCCN1C[C@@H](F)C2 |
| InChI | InChI=1S/C12H22FNO/c1-2-3-7-15-10-12-5-4-6-14(12)9-11(13)8-12/h11H,2-10H2,1H3/t11-,12+/m0/s1 |
| InChIKey | JEQFUJVWLSRSKS-NWDGAFQWSA-N |
| XLogP | 2.38 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.31 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|