C13H21F — CID 168881204
(3R,4aS,7R)-4a-ethyl-3-fluoro-7-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalene (PubChem CID 168881204) has the molecular formula C13H21F and a molecular weight of 196.31 g/mol. Its IUPAC name is (3R,4aS,7R)-4a-ethyl-3-fluoro-7-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalene.
| Compound Name | (3R,4aS,7R)-4a-ethyl-3-fluoro-7-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
|---|---|
| PubChem CID | 168881204 |
| Molecular Formula | C13H21F |
| Molecular Weight | 196.31 g/mol |
| Exact Mass | 196.16 |
| IUPAC Name | (3R,4aS,7R)-4a-ethyl-3-fluoro-7-methyl-2,3,4,5,6,7-hexahydro-1H-naphthalene |
| SMILES | CC[C@@]12CC[C@@H](C)C=C1CC[C@@H](F)C2 |
| InChI | InChI=1S/C13H21F/c1-3-13-7-6-10(2)8-11(13)4-5-12(14)9-13/h8,10,12H,3-7,9H2,1-2H3/t10-,12-,13+/m1/s1 |
| InChIKey | ZABYTRVSRIHBIQ-RTXFEEFZSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.31 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|