About methoxymethane;4-propyloctane
methoxymethane;4-propyloctane (PubChem CID 168881414) has the molecular formula C13H30O
and a molecular weight of 202.38 g/mol. Its IUPAC name is methoxymethane;4-propyloctane.
Molecular Properties
| Compound Name | methoxymethane;4-propyloctane |
| PubChem CID | 168881414 |
| Molecular Formula | C13H30O |
| Molecular Weight | 202.38 g/mol |
| Exact Mass | 202.23 |
| IUPAC Name | methoxymethane;4-propyloctane |
| SMILES | CCCCC(CCC)CCC.COC |
| InChI | InChI=1S/C11H24.C2H6O/c1-4-7-10-11(8-5-2)9-6-3;1-3-2/h11H,4-10H2,1-3H3;1-2H3 |
| InChIKey | QFQIOCGKLFEXHC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.38 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze methoxymethane;4-propyloctane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methoxymethane;4-propyloctane?
The IUPAC name of methoxymethane;4-propyloctane (CID 168881414) is methoxymethane;4-propyloctane.
What is the SMILES notation for methoxymethane;4-propyloctane?
The canonical SMILES for methoxymethane;4-propyloctane is CCCCC(CCC)CCC.COC.
What is the InChIKey of methoxymethane;4-propyloctane?
The InChIKey is QFQIOCGKLFEXHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H24.C2H6O/c1-4-7-10-11(8-5-2)9-6-3;1-3-2/h11H,4-10H2,1-3H3;1-2H3.
What are the key properties of methoxymethane;4-propyloctane?
methoxymethane;4-propyloctane has a molecular weight of 202.38 g/mol, XLogP of 4.66, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for methoxymethane;4-propyloctane is sourced from PubChem (CID 168881414), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).