C11H18FN — CID 168881478
(1S,8R)-1-fluoro-8-(2-methylprop-2-enyl)-1,2,3,5,6,7-hexahydropyrrolizine (PubChem CID 168881478) has the molecular formula C11H18FN and a molecular weight of 183.27 g/mol. Its IUPAC name is (1S,8R)-1-fluoro-8-(2-methylprop-2-enyl)-1,2,3,5,6,7-hexahydropyrrolizine.
| Compound Name | (1S,8R)-1-fluoro-8-(2-methylprop-2-enyl)-1,2,3,5,6,7-hexahydropyrrolizine |
|---|---|
| PubChem CID | 168881478 |
| Molecular Formula | C11H18FN |
| Molecular Weight | 183.27 g/mol |
| Exact Mass | 183.14 |
| IUPAC Name | (1S,8R)-1-fluoro-8-(2-methylprop-2-enyl)-1,2,3,5,6,7-hexahydropyrrolizine |
| SMILES | C=C(C)C[C@@]12CCCN1CC[C@@H]2F |
| InChI | InChI=1S/C11H18FN/c1-9(2)8-11-5-3-6-13(11)7-4-10(11)12/h10H,1,3-8H2,2H3/t10-,11+/m0/s1 |
| InChIKey | FDRCTEAXSLRQDT-WDEREUQCSA-N |
| XLogP | 2.53 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.27 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|