About 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane
6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane (PubChem CID 168881656) has the molecular formula C15H27N
and a molecular weight of 221.39 g/mol. Its IUPAC name is 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane.
Molecular Properties
| Compound Name | 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane |
| PubChem CID | 168881656 |
| Molecular Formula | C15H27N |
| Molecular Weight | 221.39 g/mol |
| Exact Mass | 221.21 |
| IUPAC Name | 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane |
| SMILES | C/C=C(/C)c1ccc(C)c(C)n1.CC.CC |
| InChI | InChI=1S/C11H15N.2C2H6/c1-5-8(2)11-7-6-9(3)10(4)12-11;2*1-2/h5-7H,1-4H3;2*1-2H3/b8-5-;; |
| InChIKey | GYROGCMNQWEHTA-XTKZWJJBSA-N |
| XLogP | 5.17 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 221.39 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane?
The IUPAC name of 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane (CID 168881656) is 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane.
What is the SMILES notation for 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane?
The canonical SMILES for 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane is C/C=C(/C)c1ccc(C)c(C)n1.CC.CC.
What is the InChIKey of 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane?
The InChIKey is GYROGCMNQWEHTA-XTKZWJJBSA-N. The full InChI is InChI=1S/C11H15N.2C2H6/c1-5-8(2)11-7-6-9(3)10(4)12-11;2*1-2/h5-7H,1-4H3;2*1-2H3/b8-5-;;.
What are the key properties of 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane?
6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane has a molecular weight of 221.39 g/mol, XLogP of 5.17, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[(Z)-but-2-en-2-yl]-2,3-dimethylpyridine;ethane is sourced from PubChem (CID 168881656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).