About 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid
1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid (PubChem CID 168882197) has the molecular formula C24H30N2O6
and a molecular weight of 442.51 g/mol. Its IUPAC name is 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid |
| PubChem CID | 168882197 |
| Molecular Formula | C24H30N2O6 |
| Molecular Weight | 442.51 g/mol |
| Exact Mass | 442.21 |
| IUPAC Name | 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid |
| SMILES | O=C1CCC(c2ccc(OC3CCC(C(=O)N4CCC(C(=O)O)CC4)CC3)cc2)C(=O)N1 |
| InChI | InChI=1S/C24H30N2O6/c27-21-10-9-20(22(28)25-21)15-1-5-18(6-2-15)32-19-7-3-16(4-8-19)23(29)26-13-11-17(12-14-26)24(30)31/h1-2,5-6,16-17,19-20H,3-4,7-14H2,(H,30,31)(H,25,27,28) |
| InChIKey | DPJXTRIULDSWAZ-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 113.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 442.51 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid?
The IUPAC name of 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid (CID 168882197) is 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid.
What is the SMILES notation for 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid?
The canonical SMILES for 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid is O=C1CCC(c2ccc(OC3CCC(C(=O)N4CCC(C(=O)O)CC4)CC3)cc2)C(=O)N1.
What is the InChIKey of 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid?
The InChIKey is DPJXTRIULDSWAZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H30N2O6/c27-21-10-9-20(22(28)25-21)15-1-5-18(6-2-15)32-19-7-3-16(4-8-19)23(29)26-13-11-17(12-14-26)24(30)31/h1-2,5-6,16-17,19-20H,3-4,7-14H2,(H,30,31)(H,25,27,28).
What are the key properties of 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid?
1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid has a molecular weight of 442.51 g/mol, XLogP of 2.47, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[4-(2,6-dioxopiperidin-3-yl)phenoxy]cyclohexanecarbonyl]piperidine-4-carboxylic acid is sourced from PubChem (CID 168882197), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).