C23H30N4O5 — CID 168882533
1-[1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]piperidine-4-carbonyl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 168882533) has the molecular formula C23H30N4O5 and a molecular weight of 442.52 g/mol. Its IUPAC name is 1-[1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]piperidine-4-carbonyl]-4-methylpiperidine-4-carboxylic acid.
| Compound Name | 1-[1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]piperidine-4-carbonyl]-4-methylpiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 168882533 |
| Molecular Formula | C23H30N4O5 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.22 |
| IUPAC Name | 1-[1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]piperidine-4-carbonyl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(C(=O)C2CCN(c3ccc(C4CCC(=O)NC4=O)cn3)CC2)CC1 |
| InChI | InChI=1S/C23H30N4O5/c1-23(22(31)32)8-12-27(13-9-23)21(30)15-6-10-26(11-7-15)18-4-2-16(14-24-18)17-3-5-19(28)25-20(17)29/h2,4,14-15,17H,3,5-13H2,1H3,(H,31,32)(H,25,28,29) |
| InChIKey | UPQDNKORZNXRBM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 119.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|