About 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid
1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid (PubChem CID 168882542) has the molecular formula C17H21N3O4
and a molecular weight of 331.37 g/mol. Its IUPAC name is 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid.
Molecular Properties
| Compound Name | 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid |
| PubChem CID | 168882542 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid |
| SMILES | CC1(C(=O)O)CCN(c2ccc(C3CCC(=O)NC3=O)cn2)CC1 |
| InChI | InChI=1S/C17H21N3O4/c1-17(16(23)24)6-8-20(9-7-17)13-4-2-11(10-18-13)12-3-5-14(21)19-15(12)22/h2,4,10,12H,3,5-9H2,1H3,(H,23,24)(H,19,21,22) |
| InChIKey | VKHFHDKXYGUODX-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 99.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid?
The IUPAC name of 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid (CID 168882542) is 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid.
What is the SMILES notation for 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid?
The canonical SMILES for 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid is CC1(C(=O)O)CCN(c2ccc(C3CCC(=O)NC3=O)cn2)CC1.
What is the InChIKey of 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid?
The InChIKey is VKHFHDKXYGUODX-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H21N3O4/c1-17(16(23)24)6-8-20(9-7-17)13-4-2-11(10-18-13)12-3-5-14(21)19-15(12)22/h2,4,10,12H,3,5-9H2,1H3,(H,23,24)(H,19,21,22).
What are the key properties of 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid?
1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid has a molecular weight of 331.37 g/mol, XLogP of 1.29, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[5-(2,6-dioxopiperidin-3-yl)-2-pyridinyl]-4-methylpiperidine-4-carboxylic acid is sourced from PubChem (CID 168882542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).